| Catalog Number |
ACM1219798670 |
| CAS |
1219798-67-0 |
| Synonyms |
Butyl 4-hydroxybenzoate-2,3,5,6-d4 |
| IUPAC Name |
butyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate |
| Molecular Weight |
198.25 |
| Molecular Formula |
198.25 |
| InChI |
InChI=1S/C11H14O3/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9/h4-7,12H,2-3,8H2,1H3/i4D,5D,6D,7D |
| InChI Key |
QFOHBWFCKVYLES-UGWFXTGHSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
HOC6D4COOCH2CH2CH2CH3 |
| Exact Mass |
198.11900 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1C(=O)OCCCC)[2H])[2H])O)[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
94-26-8 |
| Unlabeled Synonyms |
n-Butylparaben |
