| Catalog Number |
ACM1331909693 |
| CAS |
1331909-69-3 |
| Synonyms |
N-Acetyl-3-(propyl-d7-thio)alanine |
| IUPAC Name |
(2R)-2-acetamido-3-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)propanoic acid |
| Molecular Weight |
212.31 |
| Canonical SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])SC[C@@H](C(=O)O)NC(=O)C |
| InChI |
InChI=1S/C8H15NO3S/c1-3-4-13-5-7(8(11)12)9-6(2)10/h7H,3-5H2,1-2H3,(H,9,10)(H,11,12)/t7-/m0/s1/i1D3,3D2,4D2 |
| InChI Key |
PSOKBYBSKZWNMI-DPYIPTSLSA-N |
| Chemical Formula |
CD3CD2CD2SCH2CH(NHCOCH3)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
14402-54-1 |
| Unlabeled Synonyms |
L-S-Propylmercapturic acid |
