N-Acetyl-S-benzyl-2,3,4,5,6-d5-L-cysteine
| Catalog Number |
ACM1955496817 |
| CAS |
1955496-81-7 |
| Synonyms |
N-Acetyl-S-(phenylmethyl-d5)-L-cysteine; N-Acetyl-3-(benzylthio-d5)-alanine; Benzylmercapturic-d5 acid; Acetyl benzyl-d5 cysteine; S-Benzylmercapturic-d5 acid |
| Molecular Weight |
258.35 |
| Molecular Formula |
C12H10D5NO3S |
| Chemical Formula |
C6D5CH2SCH2CH(NHCOCH3)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
19542-77-9 |
| Unlabeled Synonyms |
L-S-Benzylmercapturic acid; Ac-L-Cys(Bzl)-OH |
Please kindly note that our products and services are for research use only.
