Catalog Number |
ACM1331894575 |
CAS |
1331894-57-5 |
Synonyms |
Dicyclohexylammonium N-acetyl-S-(2-hydroxyethyl-1,1,2,2-d4)-L-cysteinate |
IUPAC Name |
(2R)-2-acetamido-3-(1,1,2,2-tetradeuterio-2-hydroxyethyl)sulfanylpropanoic acid;N-cyclohexylcyclohexanamine |
Molecular Weight |
392.59 |
Molecular Formula |
C19H32D4N2O4S |
Canonical SMILES |
[2H]C([2H])(C([2H])([2H])SC[C@@H](C(=O)O)NC(=O)C)O.C1CCC(CC1)NC2CCCCC2 |
InChI |
InChI=1S/C12H23N.C7H13NO4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5(10)8-6(7(11)12)4-13-3-2-9/h11-13H,1-10H2;6,9H,2-4H2,1H3,(H,8,10)(H,11,12)/t;6-/m.0/s1/i;2D2,3D2 |
InChI Key |
XLGHARKAPCCVFZ-XAEDZKCESA-N |
Chemical Formula |
HOCD2CD2SCH2CH(NHCOCH3)COOH·(C6H11)2NH |
Hazards |
Non-hazardous for transport. |
Isotopic Enrichment |
99 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
CAS (Unlabeled) |
1331896-18-4 |
Synonyms (Unlabeled) |
L-S-(2-Hydroxyethyl)mercapturic acid dicyclohexylamine salt |