| Catalog Number |
ACM89829696-1 |
| CAS |
89829-69-6 |
| Structure |
 |
| Synonyms |
N-Acetyl-L-aspartic acid-d3 |
| IUPAC Name |
2-acetamido-2,3,3-trideuteriobutanedioic acid |
| Molecular Weight |
178.16 |
| Molecular Formula |
C6H6D3NO5 |
| Canonical SMILES |
[2H]C([2H])(C(=O)O)C([2H])(C(=O)O)NC(=O)C |
| InChI |
InChI=1S/C6H9NO5/c1-3(8)7-4(6(11)12)2-5(9)10/h4H,2H2,1H3,(H,7,8)(H,9,10)(H,11,12)/i2D2,4D |
| InChI Key |
OTCCIMWXFLJLIA-OVLJBECYSA-N |
| Purity |
97% |
| Chemical Formula |
HOOCCD2CD(NHCOCH3)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
2545-40-6 |
| Unlabeled Synonyms |
(±)-2-Acetamidosuccinic acid; Ac-DL-Asp-OH |
