| Catalog Number |
ACM1219805829 |
| CAS |
1219805-82-9 |
| Synonyms |
2,2-Dideuterio-2-[(2,2,2-trideuterioacetyl)amino]acetic acid |
| IUPAC Name |
2,2-dideuterio-2-[(2,2,2-trideuterioacetyl)amino]acetic acid |
| Molecular Weight |
122.13 |
| Molecular Formula |
C4H2D5NO3 |
| Canonical SMILES |
[2H]C([2H])([2H])C(=O)NC([2H])([2H])C(=O)O |
| InChI |
InChI=1S/C4H7NO3/c1-3(6)5-2-4(7)8/h2H2,1H3,(H,5,6)(H,7,8)/i1D3,2D2 |
| InChI Key |
OKJIRPAQVSHGFK-ZBJDZAJPSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
CD3CONHCD2COOH |
| Exact Mass |
122.07400 |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
543-24-8 |
| Unlabeled Synonyms |
Acetamidoacetic acid; Aceturic acid; Ac-Gly-OH |
