| Catalog Number |
ACM203805872-1 |
| CAS |
203805-87-2 |
| Structure |
 |
| Synonyms |
HEPES (D18) |
| IUPAC Name |
deuterio 1,1,2,2-tetradeuterio-2-[2,2,3,3,5,5,6,6-octadeuterio-4-(1,1,2,2-tetradeuterio-2-deuteriooxyethyl)piperazin-1-yl]ethanesulfonate |
| Molecular Weight |
256.41 |
| Molecular Formula |
C8D18N2O4S |
| InChI |
InChI=1S/C8H18N2O4S/c11-7-5-9-1-3-10(4-2-9)6-8-15(12,13)14/h11H,1-8H2,(H,12,13,14)/i1D2,2D2,3D2,4D2,5D2,6D2,7D2,8D2,11D/hD |
| InChI Key |
JKMHFZQWWAIEOD-MMODJCGESA-N |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1(C(N(C(C(N1C([2H])([2H])C([2H])([2H])O[2H])([2H])[2H])([2H])[2H])C([2H])([2H])C([2H])([2H])S(=O)(=O)O[2H])([2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| CAS (Unlabeled) |
7365-45-9 |
| Synonyms (Unlabeled) |
HEPES; 4-(2-Hydroxyethyl)piperazine-1-ethanesulfonic acid |
