mono-n-Propyl Phthalate-3,4,5,6-d4 (99 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM1795020915-1 |
| CAS |
1795020-91-5 |
| Structure |
 |
| Synonyms |
1,2-(Benzene-d4)dicarboxylic Acid 1-Propyl Ester, 1,2-(Benzene-d4)dicarboxylic Acid Monopropyl Ester, Phthalic Acid-d4 Monopropyl Ester, Phthalic Acid-d4 Propyl Ester, Mono-n-propyl phthalate-d4, NSC 309966-d4 |
| Molecular Weight |
212.24 |
| Molecular Formula |
C11H8D4O4 |
| Canonical SMILES |
O=C(OCCC)C1=C([2H])C([2H])=C([2H])C([2H])=C1C(O)=O |
| Format |
Neat |
| SIL Type |
Deuterium |
| Unlabeled CAS |
4376-19-6 |
Please kindly note that our products and services are for research use only.
