mono-n-Pentyl Phthalate-3,4,5,6-d4 (99 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM1794756287-1 |
| CAS |
1794756-28-7 |
| Structure |
 |
| Synonyms |
1,2-(Benzene-d4)dicarboxylic Acid 1-Pentyl Ester, 1,2-(Benzene-d4)dicarboxylic Acid Monopentyl Ester, Phthalic Acid-d4 Monopentyl Ester, Phthalic Acid-d4 Pentyl Ester, Mono-n-pentyl Phthalate-d4, Monoamyl Phthalate-d4, MPP-d4 |
| Molecular Formula |
C13H12D4O4 |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c(C(=O)OCCCCC)c(C(=O)O)c1[2H] |
| Format |
Neat |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
