mono-Methyl Phthalate-3,4,5,6-d4 (99 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM1276197400-2 |
| CAS |
1276197-40-0 |
| Structure |
 |
| Synonyms |
1,2-(Benzene-d4)dicarboxylic Acid 1-Methyl Ester, Phthalic Acid-d4 Methyl Ester, Phthalic Acid-d4 Monomethyl Ester, 2-(1-Methoxycarbonyl)benzoic Acid-d4, Methyl 2-Carboxybenzoate-d4, Methyl Hydrogen Phthalate-d4, Methyl Phthalate-d4, MMP-d4, NSC 8281-d4 |
| Molecular Weight |
184.18 |
| Molecular Formula |
C9H4D4O4 |
| Canonical SMILES |
O=C(OC)C1=C([2H])C([2H])=C([2H])C([2H])=C1C(O)=O |
| Format |
Neat |
| SIL Type |
Deuterium |
| Unlabeled CAS |
4376-18-5 |
Please kindly note that our products and services are for research use only.
