mono-Benzyl Phthalate-3,4,5,6-d4 (99 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM478954835-3 |
| CAS |
478954-83-5 |
| Structure |
 |
| IUPAC Name |
2,3,4,5-tetradeuterio-6-phenylmethoxycarbonylbenzoic acid |
| Molecular Weight |
260.28 |
| Molecular Formula |
C15D4H8O4 |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c(C(=O)OCc2ccccc2)c(C(=O)O)c1[2H] |
| InChI |
InChI=1S/C15H12O4/c16-14(17)12-8-4-5-9-13(12)15(18)19-10-11-6-2-1-3-7-11/h1-9H,10H2,(H,16,17)/i4D,5D,8D,9D |
| Accurate Mass |
260.0987 |
| Format |
Neat |
| SIL Type |
Deuterium |
| Unlabeled CAS |
2528-16-7 |
Please kindly note that our products and services are for research use only.
