Metolachlor D6 (propyl D6) 100 µg/mL in Acetone
| Catalog Number |
ACM1219803970-2 |
| CAS |
1219803-97-0 |
| Structure |
 |
| IUPAC Name |
2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1,1,1,2,3,3-hexadeuterio-3-methoxypropan-2-yl)acetamide |
| Molecular Weight |
289.83 |
| Molecular Formula |
C15D6H16ClNO2 |
| Canonical SMILES |
[2H]C([2H])([2H])C([2H])(N(C(=O)CCl)c1c(C)cccc1CC)C([2H])([2H])OC |
| InChI |
InChI=1S/C15H22ClNO2/c1-5-13-8-6-7-11(2)15(13)17(14(18)9-16)12(3)10-19-4/h6-8,12H,5,9-10H2,1-4H3/i3D3,10D2,12D |
| Storage |
+20 °C |
| Accurate Mass |
289.1716 |
| Alternative CAS |
51218-45-2 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
