Metobromuron D6 (methyl D3 methoxy D3) 100 µg/mL in Acetone
| Catalog Number |
ACM2732834841 |
| CAS |
2732834-84-1 |
| Structure |
 |
| Synonyms |
Metobromuron D6 (methyl D3 methoxy D3) |
| IUPAC Name |
3-(4-bromophenyl)-1-(trideuteriomethoxy)-1-(trideuteriomethyl)urea |
| Molecular Weight |
265.14 |
| Molecular Formula |
C9D6H5BrN2O2 |
| Canonical SMILES |
[2H]C([2H])([2H])ON(C(=O)Nc1ccc(Br)cc1)C([2H])([2H])[2H] |
| InChI |
InChI=1S/C9H11BrN2O2/c1-12(14-2)9(13)11-8-5-3-7(10)4-6-8/h3-6H,1-2H3,(H,11,13)/i1D3,2D3 |
| Storage |
+20 °C |
| Accurate Mass |
264.0381 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
