| Catalog Number |
ACM93951930-1 |
| CAS |
93951-93-0 |
| Structure |
 |
| Synonyms |
2-Methylpyridine-d7, o-Picoline-d7, o-Methylpyridine-d7, ortho-Picoline-d7, ortho-Methylpyridine-d7 |
| IUPAC Name |
2,3,4,5-tetradeuterio-6-(trideuteriomethyl)pyridine |
| Molecular Weight |
100.17 |
| Molecular Formula |
C6D7N |
| Canonical SMILES |
[2H]c1nc(c([2H])c([2H])c1[2H])C([2H])([2H])[2H] |
| InChI |
InChI=1S/C6H7N/c1-6-4-2-3-5-7-6/h2-5H,1H3/i1D3,2D,3D,4D,5D |
| InChI Key |
BSKHPKMHTQYZBB-AAYPNNLASA-N |
| Flash Point |
79 °F |
| Purity |
98 atom % D |
| Density |
1.026 g/mL at 25ºC(lit.) |
| Accurate Mass |
100.1018 |
| Exact Mass |
93.05780 |
| Format |
Neat |
| Functional Group |
Amines & Amine Salts,Heterocycles |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.5 g
In Stock
1 g
In Stock |
| Shipping Hazards |
FLAMMABLE LIQUID |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
109-06-8 |
