| Catalog Number |
ACM93952035-1 |
| CAS |
93952-03-5 |
| Structure |
 |
| Synonyms |
Benzene-1,2,4,5-d4, 3-(methyl-d3)-6-[1-(methyl-d3)ethyl-1,2,2,2-d4]- (9CI), 2-(4-Methylphenyl)propane-d14, 4-Isopropyltoluene D14, p-Cymene D14 |
| IUPAC Name |
1,2,4,5-tetradeuterio-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-6-(trideuteriomethyl)benzene |
| Molecular Weight |
148.3 |
| Molecular Formula |
C10D14 |
| Canonical SMILES |
[2H]c1c([2H])c(c([2H])c([2H])c1C([2H])([2H])[2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI |
InChI=1S/C10H14/c1-8(2)10-6-4-9(3)5-7-10/h4-8H,1-3H3/i1D3,2D3,3D3,4D,5D,6D,7D,8D |
| Purity |
98 atom % D |
| Accurate Mass |
148.1974 |
| Alternative CAS |
99-87-6 |
| Format |
Neat |
| Functional Group |
Hydrocarbons - Other Aromatic |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.5 g
In Stock
1 g
In Stock |
| Shipping Hazards |
FLAMMABLE LIQUID |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
99-87-6 |
