| Catalog Number |
ACM7297452-1 |
| CAS |
7297-45-2 |
| Structure |
 |
| Synonyms |
Naphthalene-1,2,3,4,5,6,8-d7, 7-(methyl-d3)-,7-(Methyl-d3)naphthalene-1,2,3,4,5,6,8-d7, ß-Methylnaphthalene-d10, 2-Methylnaphthalene D10 |
| IUPAC Name |
1,2,3,4,5,6,8-heptadeuterio-7-(trideuteriomethyl)naphthalene |
| Molecular Weight |
152.26 |
| Molecular Formula |
C11D10 |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c2c([2H])c(c([2H])c([2H])c2c1[2H])C([2H])([2H])[2H] |
| InChI |
InChI=1S/C11H10/c1-9-6-7-10-4-2-3-5-11(10)8-9/h2-8H,1H3/i1D3,2D,3D,4D,5D,6D,7D,8D |
| Purity |
98 atom % D |
| Accurate Mass |
152.141 |
| Format |
Neat |
| Functional Group |
Hydrocarbons - Other Aromatic |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.5 g
In Stock
1 g
In Stock |
| Shipping Hazards |
NON-HAZARDOUS FOR TRANSPORT |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
91-57-6 |
