| Catalog Number |
ACM38072945 |
| CAS |
38072-94-5 |
| Structure |
 |
| Synonyms |
α-Methylnaphthalene |
| IUPAC Name |
1,2,3,4,5,6,7-heptadeuterio-8-(trideuteriomethyl)naphthalene |
| Molecular Weight |
152.26 |
| Molecular Formula |
C11D10 |
| InChI |
InChI=1S/C11H10/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2-8H,1H3/i1D3,2D,3D,4D,5D,6D,7D,8D |
| InChI Key |
QPUYECUOLPXSFR-UZHHFJDZSA-N |
| Boiling Point |
240-243 °C (lit.) |
| Flash Point |
180 °F |
| Purity |
98 atom % D |
| Density |
1.070 g/mL at 25 °C |
| Functional Group |
Hydrocarbons - Other Aromatic |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2C([2H])([2H])[2H])[2H])[2H])[2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.5 g
In Stock |
| Shipping Hazards |
NON-HAZARDOUS FOR TRANSPORT |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
90-12-0 |
| Unlabeled Synonyms |
α-Methylnaphthalene |
