| Catalog Number |
ACM2022152969 |
| CAS |
2022152-96-9 |
| IUPAC Name |
methyl (E)-2,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoate |
| Molecular Weight |
169.23 |
| Molecular Formula |
C10H3D7O2 |
| InChI |
InChI=1S/C10H10O2/c1-12-10(11)8-7-9-5-3-2-4-6-9/h2-8H,1H3/b8-7+/i2D,3D,4D,5D,6D,7D,8D |
| InChI Key |
CCRCUPLGCSFEDV-RTRAALMGSA-N |
| Chemical Formula |
C6D5CD=CDCOOCH3 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])/C(=C(\[2H])/C(=O)OC)/[2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
1754-62-7 |
| Unlabeled Synonyms |
Methyl trans-3-phenylacrylate |
