| Catalog Number |
ACM61764827-1 |
| CAS |
61764-82-7 |
| Structure |
 |
| IUPAC Name |
methyl (E)-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoate |
| Molecular Weight |
167.22 |
| Molecular Formula |
C10H5D5O2 |
| InChI |
InChI=1S/C10H10O2/c1-12-10(11)8-7-9-5-3-2-4-6-9/h2-8H,1H3/b8-7+/i2D,3D,4D,5D,6D |
| InChI Key |
CCRCUPLGCSFEDV-XLKVIOBLSA-N |
| Chemical Formula |
C6D5CH=CHCOOCH3 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])/C=C/C(=O)OC)[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
1754-62-7 |
| Unlabeled Synonyms |
Methyl trans-3-phenylacrylate |
