| Catalog Number |
ACM434349936 |
| CAS |
434349-93-6 |
| Structure |
 |
| Synonyms |
Myristic acid methyl ester-d27 |
| IUPAC Name |
methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptacosadeuteriotetradecanoate |
| Molecular Weight |
269.57 |
| Molecular Formula |
C15H3D27O2 |
| InChI |
InChI=1S/C15H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2/h3-14H2,1-2H3/i1D3,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2,14D2 |
| InChI Key |
ZAZKJZBWRNNLDS-NFTMZUINSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
CD3(CD2)12COOCH3 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)OC |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
124-10-7 |
| Unlabeled Synonyms |
Methyl myristate |
