| Catalog Number |
ACM1219804677 |
| CAS |
1219804-67-7 |
| IUPAC Name |
methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecadeuteriodecanoate |
| Molecular Weight |
205.41 |
| Molecular Formula |
C11H3D19O2 |
| InChI |
InChI=1S/C11H22O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-10H2,1-2H3/i1D3,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2 |
| InChI Key |
YRHYCMZPEVDGFQ-MWHBIPIPSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
CD3(CD2)8COOCH3 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)OC |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
110-42-9 |
| Unlabeled Synonyms |
Methyl caprate |
