Methiocarb D3 (N-methyl D3)
| Catalog Number |
ACM1581694941-1 |
| CAS |
1581694-94-1 |
| Structure |
 |
| Synonyms |
Methiocarb D3 (N-methyl D3) |
| IUPAC Name |
(3,5-dimethyl-4-methylsulfanylphenyl) N-(trideuteriomethyl)carbamate |
| Molecular Weight |
228.33 |
| Molecular Formula |
C11D3H12NO2S |
| Canonical SMILES |
[2H]C([2H])([2H])NC(=O)Oc1cc(C)c(SC)c(C)c1 |
| InChI |
InChI=1S/C11H15NO2S/c1-7-5-9(14-11(13)12-3)6-8(2)10(7)15-4/h5-6H,1-4H3,(H,12,13)/i3D3 |
| Storage |
+20 °C |
| Accurate Mass |
228.1012 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
2032-65-7 |
Please kindly note that our products and services are for research use only.
