| Catalog Number |
ACM287476113-1 |
| CAS |
287476-11-3 |
| Structure |
 |
| Description |
Melamine-15N3 is a 15N-labeled melamine. Melamine is a metabolite of cyromazine. Melamine is an intermediate for the synthesis of melamine resin and plastic materials. Melamine is used as a chemical raw material and is harmful to the body and cannot be used in food processing or food additives. |
| Synonyms |
1,3,5-Triazine-2,4,6-triamine-[15N3] |
| IUPAC Name |
1,3,5-triazine-2,4,6-tri(15N3)amine |
| Molecular Weight |
129.1 |
| Molecular Formula |
C3H6N315N3 |
| Canonical SMILES |
[15NH2]C1=NC([15NH2])=NC([15NH2])=N1 |
| InChI |
InChI=1S/C3H6N6/c4-1-7-2(5)9-3(6)8-1/h(H6,4,5,6,7,8,9)/i4+1,5+1,6+1 |
| InChI Key |
JDSHMPZPIAZGSV-VMGGCIAMSA-N |
| Melting Point |
>300 °C |
| Flash Point |
300 °C |
| Purity |
≥98.0% |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Accurate Mass |
129.0565 |
| Format |
Neat |
| Isomeric SMILES |
C1(=NC(=NC(=N1)[15NH2])[15NH2])[15NH2] |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
| Shipping Temperature |
Room temperature |
| Storage Conditions |
-20 °C Freezer |
| Unlabeled CAS |
108-78-1 |
