Mecoprop-methyl ester D3 (phenyl D3) 100 µg/mL in Acetone
| Catalog Number |
ACM2714414192 |
| CAS |
2714414-19-2 |
| Structure |
 |
| Synonyms |
Mecoprop-methyl ester D3 (ring D3) |
| IUPAC Name |
methyl 2-(4-chloro-2,3,5-trideuterio-6-methylphenoxy)propanoate |
| Molecular Weight |
231.69 |
| Molecular Formula |
C11D3H10ClO3 |
| Canonical SMILES |
[2H]c1c([2H])c(OC(C)C(=O)OC)c(C)c([2H])c1Cl |
| InChI |
InChI=1S/C11H13ClO3/c1-7-6-9(12)4-5-10(7)15-8(2)11(13)14-3/h4-6,8H,1-3H3/i4D,5D,6D |
| Storage |
+20 °C |
| Accurate Mass |
231.0742 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
