Mapenterol D11 hydrochloride
| Catalog Number |
ACM1325559189 |
| CAS |
1325559-18-9 |
| Synonyms |
1-[4-Amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[[1,1,1,3,3,4,4,4-octadeuterio-2-(trideuteriomethyl)butan-2-yl]amino]ethanol hydrochloride, Mapenterol-D11 hydrochloride, Mapenterol-d11 hydrochloride (2-methylbutan-2-yl-d11) |
| IUPAC Name |
1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[[1,1,1,3,3,4,4,4-octadeuterio-2-(trideuteriomethyl)butan-2-yl]amino]ethanol;hydrochloride |
| Molecular Weight |
372.3 |
| Molecular Formula |
C14D11H9ClF3N2O·ClH |
| Canonical SMILES |
Cl.[2H]C([2H])([2H])C([2H])([2H])C(NCC(O)c1cc(Cl)c(N)c(c1)C(F)(F)F)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Storage |
+4 °C |
| Accurate Mass |
371.1673 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
