Mabuterol D9 hydrochloride
| Catalog Number |
ACM1353867830 |
| CAS |
1353867-83-0 |
| Structure |
 |
| Synonyms |
1-(4-Amino-3-chloro-5-trifluoromethyl-phenyl-D9)-2-tert-butylamino-ethanol hydrochloride, Benzenemethanol, 4-amino-3-chloro-a-[[(1,1-dimethethyl-D9)amino]methyl]-5-(trifluoromethyl)-, hydrochloride (1:1), Mabuterol D9 hydrochloride |
| IUPAC Name |
1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]ethanol;hydrochloride |
| Molecular Weight |
356.26 |
| Molecular Formula |
C13D9H9ClF3N2O·ClH |
| Canonical SMILES |
Cl.[2H]C([2H])([2H])C(NCC(O)c1cc(Cl)c(N)c(c1)C(F)(F)F)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Storage |
+20 °C |
| Accurate Mass |
355.1391 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
