m-Xylene-alpha,alpha,alpha,alpha',alpha',alpha'-d6
| Catalog Number |
ACM29636655-2 |
| CAS |
29636-65-5 |
| Structure |
 |
| Synonyms |
m-Xylene D6 (Dimethyl D6), m-Xylene D6 (dimethyl D6), m-Xylene-a,a,a,a',a',a'-d6 (6CI,8CI), Benzene, 1,3-di(methyl-d3)- (9CI) |
| IUPAC Name |
1,3-bis(trideuteriomethyl)benzene |
| Molecular Weight |
112.2 |
| Molecular Formula |
C8D6H4 |
| Canonical SMILES |
[2H]C([2H])([2H])c1cccc(c1)C([2H])([2H])[2H] |
| InChI |
InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3/i1D3,2D3 |
| Accurate Mass |
112.1159 |
| Format |
Neat |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
