| Catalog Number |
ACM202325517-1 |
| CAS |
202325-51-7 |
| Structure |
 |
| Synonyms |
3-Methylphenol-d7, 1-Hydroxy-3-methylbenzene-d7, 3-Hydroxytoluene-d7, 3-Methylphenol-d7, NSC 8768-d7, m-Cresylic Acid-d7, m-Hydroxytoluene-d7, m-Kresol-d7, m-Methylphenol-d7, m-Oxytoluene-d7, m-Toluol-d7, meta-Cresol-d7 |
| IUPAC Name |
2,3,4,6-tetradeuterio-5-(trideuteriomethyl)phenol |
| Molecular Weight |
115.18 |
| Molecular Formula |
C7D7HO |
| Canonical SMILES |
[2H]c1c([2H])c(O)c([2H])c(c1[2H])C([2H])([2H])[2H] |
| InChI |
InChI=1S/C7H8O/c1-6-3-2-4-7(8)5-6/h2-5,8H,1H3/i1D3,2D,3D,4D,5D |
| InChI Key |
RLSSMJSEOOYNOY-AAYPNNLASA-N |
| Purity |
98 atom % D |
| Accurate Mass |
115.1015 |
| Exact Mass |
115.10100 |
| Format |
Neat |
| Functional Group |
Alcohols & Phenols |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.25 g
In Stock
0.5 g
In Stock |
| Shipping Hazards |
TOXIC & CORROSIVE |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
108-39-4 |
