Losartan Carboxaldehyde-d3
| Catalog Number |
ACM1184999265 |
| CAS |
1184999-26-5 |
| Structure |
 |
| Synonyms |
2-(Butyl-d3)-4-chloro-1-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl]-1H-imidazole-5-carboxaldehyde, EXP 3179, DUP 167 |
| IUPAC Name |
5-chloro-3-[[4-[2-(1H-tetrazol-5-yl)phenyl]phenyl]methyl]-2-(4,4,4-trideuteriobutyl)imidazole-4-carbaldehyde |
| Molecular Weight |
423.91 |
| Molecular Formula |
C22D3H18ClN6O |
| Canonical SMILES |
[2H]C([2H])([2H])CCCc1nc(Cl)c(C=O)n1Cc2ccc(cc2)c3ccccc3c4nnn[nH]4 |
| InChI |
InChI=1S/C22H21ClN6O/c1-2-3-8-20-24-21(23)19(14-30)29(20)13-15-9-11-16(12-10-15)17-6-4-5-7-18(17)22-25-27-28-26-22/h4-7,9-12,14H,2-3,8,13H2,1H3,(H,25,26,27,28)/i1D3 |
| Storage |
+4 °C |
| Accurate Mass |
423.1654 |
| API Family |
Losartan |
| Format |
Neat |
| Shipping Temperature |
Room temperature |
| SIL Type |
Deuterium |
| Unlabeled CAS |
114798-36-6 |
Please kindly note that our products and services are for research use only.
