Linuron D6 (methyl D3 methoxy D3)
| Catalog Number |
ACM1219804768-1 |
| CAS |
1219804-76-8 |
| Structure |
 |
| Synonyms |
Linuron D6, 3-(3,4-Dichlorophenyl)-1-(trideuteriomethoxy)-1-(trideuteriomethyl)urea, Linuron-d6, Linuron D6 (methyl D3 methoxy D3) |
| IUPAC Name |
3-(3,4-dichlorophenyl)-1-(trideuteriomethoxy)-1-(trideuteriomethyl)urea |
| Molecular Weight |
255.13 |
| Molecular Formula |
C9D6H4Cl2N2O2 |
| Canonical SMILES |
[2H]C([2H])([2H])ON(C(=O)Nc1ccc(Cl)c(Cl)c1)C([2H])([2H])[2H] |
| InChI |
InChI=1S/C9H10Cl2N2O2/c1-13(15-2)9(14)12-6-3-4-7(10)8(11)5-6/h3-5H,1-2H3,(H,12,14)/i1D3,2D3 |
| Storage |
+20 °C |
| Accurate Mass |
254.0496 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
330-55-2 |
Please kindly note that our products and services are for research use only.
