| Catalog Number |
ACM1216673027-1 |
| CAS |
1216673-02-7 |
| Synonyms |
Linalool (1,1,2-D3) |
| IUPAC Name |
1,1,2-trideuterio-3,7-dimethylocta-1,6-dien-3-ol |
| Molecular Weight |
157.27 |
| Molecular Formula |
C10H15D3O |
| InChI |
InChI=1S/C10H18O/c1-5-10(4,11)8-6-7-9(2)3/h5,7,11H,1,6,8H2,2-4H3/i1D2,5D |
| InChI Key |
CDOSHBSSFJOMGT-WSWICNJZSA-N |
| Purity |
96% |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C(=C([2H])C(C)(CCC=C(C)C)O)[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store refrigerated |
| Unlabeled CAS |
78-70-6 |
| Unlabeled Synonyms |
(±)-3,7-Dimethyl-1,6-octadien-3-ol |
