| Catalog Number |
ACM153568333-1 |
| CAS |
153568-33-3 |
| Structure |
 |
| Synonyms |
BOC-VAL-OH-2,3,4,4,4,5,5,5-D8 |
| IUPAC Name |
(2S)-2,3,4,4,4-pentadeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trideuteriomethyl)butanoic acid |
| Molecular Weight |
225.31 |
| Molecular Formula |
C10H11D8NO4 |
| Canonical SMILES |
[2H][C@@](C(=O)O)(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])NC(=O)OC(C)(C)C |
| InChI |
InChI=1S/C10H19NO4/c1-6(2)7(8(12)13)11-9(14)15-10(3,4)5/h6-7H,1-5H3,(H,11,14)(H,12,13)/t7-/m0/s1/i1D3,2D3,6D,7D |
| InChI Key |
SZXBQTSZISFIAO-SSOOLOFBSA-N |
| Melting Point |
77-80 °C (lit.) |
| Chemical Formula |
(CD3)2CDCD(NH-t-BOC)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
13734-41-3 |
| Unlabeled Synonyms |
BOC-L-Valine; BOC-L-Val-OH |
