| Catalog Number |
ACM1007834061 |
| CAS |
1007834-06-1 |
| Synonyms |
FMOC-VAL-OH-2,3,4,4,4,5,5,5-D8 |
| IUPAC Name |
(2S)-2,3,4,4,4-pentadeuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(trideuteriomethyl)butanoic acid |
| Molecular Weight |
347.44 |
| Molecular Formula |
C20H13D8NO4 |
| Canonical SMILES |
[2H][C@@](C(=O)O)(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| InChI |
InChI=1S/C20H21NO4/c1-12(2)18(19(22)23)21-20(24)25-11-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17/h3-10,12,17-18H,11H2,1-2H3,(H,21,24)(H,22,23)/t18-/m0/s1/i1D3,2D3,12D,18D |
| InChI Key |
UGNIYGNGCNXHTR-CHKHYCMRSA-N |
| Melting Point |
143-145 °C (lit.) |
| Chemical Formula |
(CD3)2CDCD(NH-FMOC)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
68858-20-8 |
| Unlabeled Synonyms |
FMOC-L-Valine; FMOC-L-Val-OH |
