| Catalog Number |
ACM35045728-1 |
| CAS |
35045-72-8 |
| Structure |
 |
| Description |
L-Valine is an essential amino acid and one of the 20 proteinaceous amino acids. L-Valine-d8 is the deuterated form of L-Valine and is suitable for the synthesis of labeled intermediates. |
| Synonyms |
L-VALINE-2,3,4,4,4,5,5,5-d8 |
| IUPAC Name |
(2S)-2-amino-2,3,4,4,4-pentadeuterio-3-(trideuteriomethyl)butanoic acid |
| Molecular Weight |
125.2 |
| Molecular Formula |
C5H3D8NO2 |
| Canonical SMILES |
[2H]C([2H])([2H])C(C([2H])([2H])[2H])([2H])[C@@](N)([2H])C(O)=O |
| InChI |
InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1/i1D3,2D3,3D,4D |
| InChI Key |
KZSNJWFQEVHDMF-AYWPRJOCSA-N |
| Melting Point |
295-300 °C (subl.) (lit.) |
| Purity |
≥99.0% |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Chemical Formula |
(CD3)2CDCD(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H][C@@](C(=O)O)(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])N |
| Isotopic Enrichment |
98 atom % D |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
72-18-4 |
| Unlabeled Synonyms |
(S)-α-Aminoisovaleric acid; (S)-2-Amino-3-methylbutyric acid; H-L-Val-OH |
