| Catalog Number |
ACM59935294-2 |
| CAS |
59935-29-4 |
| Structure |
 |
| Synonyms |
(S)-α-Aminoisovaleric acid-15N, L-2-Amino-3-methylbutanoic acid-15N, 15N Labeled L-valine |
| Molecular Weight |
118.14 |
| Molecular Formula |
(CH3)2CHCH(15NH2)COOH |
| Canonical SMILES |
CC(C)[C@H]([15NH2])C(O)=O |
| InChI |
1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1/i6+1 |
| InChI Key |
KZSNJWFQEVHDMF-JGTYJTGKSA-N |
| Melting Point |
295-300 °C (subl.) (lit.) |
| Purity |
99% (CP) |
| Appearance |
solid |
| Application |
Biomolecular NMR, Metabolism, Metabolomics, Proteomics |
| Storage |
Store at room temperature away from light and moisture. |
| EC Number |
200-773-6 (Unlabeled) |
| Isotopic Enrichment |
98 atom % 15N |
| Mass Shift |
M+1 |
| MDL Number |
MFCD00084248 |
| Optical Activity |
[α]25/D +26.6°, c = 1 in 5 M HCl |
| Type |
Labeled Amino Acids and Derivatives |
| Unlabeled CAS |
72-18-4 |
