| Catalog Number |
ACM35424818-1 |
| CAS |
35424-81-8 |
| Structure |
 |
| Description |
L-Tyrosine (15N) is a non-essential amino acid that is important for protein synthesis. Tyrosine's isotope labeled counterparts can be used in NMR-based research studies designed to probe structure, dynamics and binding of biological macromolecules. |
| Synonyms |
(2S)-2-Amino-3-(4-hydroxyphenyl)propanoic acid(S)-2-Amino-3-(4-hydroxyphenyl)propionic acid-15N, 3-(4-Hydroxyphenyl)-L-alanine-15N, L-4-Hydroxyphenylalanine-15N, 15N Labeled L-tyrosine |
| Molecular Weight |
182.18 |
| Molecular Formula |
HOC6H4CH2CH(15NH2)COOH |
| Canonical SMILES |
[15NH2][C@@H](Cc1ccc(O)cc1)C(O)=O |
| InChI |
1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i10+1 |
| InChI Key |
OUYCCCASQSFEME-YTRLMEAHSA-N |
| Melting Point |
>300 °C (dec.) (lit.) |
| Appearance |
powder |
| Application |
Biomolecular NMR, Metabolism, Metabolomics, Proteomics |
| Storage |
Store at room temperature away from light and moisture. |
| EC Number |
200-460-4 (Unlabeled) |
| Isotopic Enrichment |
98 atom % 15N |
| Mass Shift |
M+1 |
| MDL Number |
MFCD00055773 |
| Optical Activity |
[α]25/D -12.0°, c = 1 in 1 M HCl |
| Type |
Labeled Amino Acids and Derivatives |
| Unlabeled CAS |
60-18-4 |
