L-Tryptophan (Indole-2-13C)
| Catalog Number |
ACM115709687 |
| CAS |
115709-68-7 |
| Molecular Weight |
205.22 |
| Molecular Formula |
13CC10H12N2O2 |
| Canonical SMILES |
C1=CC=C2C(=C1)C(=[13CH]N2)C[C@@H](C(=O)O)N |
| InChI |
InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1/i6+1 |
| InChI Key |
QIVBCDIJIAJPQS-XJBDPXLPSA-N |
| Melting Point |
280-285 °C (536-545 °F) |
| Purity |
98% |
| Appearance |
White to off-white powder |
| Chemical Formula |
(C6H4NH*CHC)CH2CH(NH2)COOH |
| Isotopic Enrichment |
98 atom % 13C |
| Unlabeled CAS |
73-22-3 |
| Unlabeled Synonyms |
(S)-2-Amino-3-(3-indolyl)propionic acid; L-alpha-Amino-3-indolepropionic acid |
Please kindly note that our products and services are for research use only.
