| Catalog Number |
ACM133519785 |
| CAS |
133519-78-5 |
| IUPAC Name |
(2R)-2-deuterio-2-(dideuterioamino)-3-(1H-indol-3-yl)propanoic acid |
| Molecular Weight |
207.25 |
| Molecular Formula |
C11H9D3N2O2 |
| Canonical SMILES |
[2H][C@@](CC1=CNC2=CC=CC=C21)(C(=O)O)N([2H])[2H] |
| InChI |
InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m1/s1/i9D/hD2 |
| InChI Key |
QIVBCDIJIAJPQS-ZZFUSJFZSA-N |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
73-22-3 |
| Unlabeled Synonyms |
(S)-2-Amino-3-(3-indolyl)propionic acid, H-L-Trp-OH |
