| Catalog Number |
ACM204634208-2 |
| CAS |
204634-20-8 |
| Structure |
 |
| Molecular Weight |
206.21 |
| Molecular Formula |
C11H1215N2O2 |
| Canonical SMILES |
[15NH2][C@@H](Cc1c[15nH]c2ccccc12)C(O)=O |
| InChI |
1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1/i12+1,13+1 |
| InChI Key |
QIVBCDIJIAJPQS-BGQAPUEUSA-N |
| Melting Point |
280-285 °C (dec.) (lit.) |
| Purity |
95% (CP) |
| Appearance |
Solid |
| Application |
A labeled essential amino acid. Acts as a building block in protein synthesis. A precursor for serotonin, niacin, and auxin. Activates a repressor protein in bacteria that binds to the trp operon, which prevents transcription of downstream DNA coding for the synthesis of tryptophan. Found in a wide variety of food sources. May improve depression symptoms. |
| Storage |
Keep container tightly closed in a dry and well-ventilated place. Store under inert gas, hygroscopic |
| Exact Mass |
206.084 |
| Isotopic Enrichment |
95 atom % 15N |
| LogP |
1.822 |
| Mass Shift |
M+2 |
| MDL Number |
MFCD00209799 |
| Optical Activity |
[α]20/D -30.5°, c = 1 in H2O |
| PSA |
79.11 |
| Quality Level |
200 |
| Stability |
Stable under recommended storage conditions. |
| Transportation |
Non-hazardous for transport |
| Type |
Labeled Amino Acids and Derivatives |
