| Catalog Number |
ACM80681090-2 |
| CAS |
80681-09-0 |
| Structure |
 |
| Description |
L-Threonine (15N) is an essential amino acid that plays an important role in protein synthesis and other metabolic functions (e.g. glycine synthesis, protein phosphorylation, O-linked glycosylation). Threonine's isotope labeled counterparts can be used in NMR-based research studies designed to probe structure, dynamics and binding of biological macromolecules. |
| Synonyms |
(2S,3R)-2-Amino-3-hydroxybutyric acid-15N, 15N Labeled L-threonine |
| Molecular Weight |
120.11 |
| Molecular Formula |
CH3CH(OH)CH(15NH2)COOH |
| Canonical SMILES |
C[C@@H](O)[C@H]([15NH2])C(O)=O |
| InChI |
1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1/i5+1 |
| InChI Key |
AYFVYJQAPQTCCC-SZEKAKMSSA-N |
| Melting Point |
256 °C (dec.) (lit.) |
| Purity |
98% (CP) |
| Density |
1.3±0.1 g/cm3 |
| Appearance |
solid |
| Application |
Biomolecular NMR, Metabolism, Metabolomics, Proteomics |
| Storage |
Store at room temperature away from light and moisture. |
| EC Number |
200-774-1 (Unlabeled) |
| Exact Mass |
120.055275 |
| Isotopic Enrichment |
98 atom % 15N |
| LogP |
1.507 |
| Mass Shift |
M+1 |
| MDL Number |
MFCD00209793 |
| Optical Activity |
[α]20/D -27.4°, c = 1 in H2O |
| PSA |
83.55 |
| Type |
Labeled Amino Acids and Derivatives |
| Unlabeled CAS |
72-19-5 |
