| Catalog Number |
ACM105591104-1 |
| CAS |
105591-10-4 |
| Structure |
 |
| IUPAC Name |
(2S)-2-amino-2,3,3-trideuterio-3-hydroxypropanoic acid |
| Molecular Weight |
108.11 |
| Molecular Formula |
C3H4D3NO3 |
| Canonical SMILES |
[2H][C@@](C(=O)O)(C([2H])([2H])O)N |
| InChI |
InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1/i1D2,2D |
| InChI Key |
MTCFGRXMJLQNBG-RBXBQAPRSA-N |
| Chemical Formula |
HOCD2CD(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
56-45-1 |
| Unlabeled Synonyms |
(S)-2-Amino-3-hydroxypropionic acid; β-Hydroxy-L-alanine; H-L-Ser-OH |
