| Catalog Number |
ACM29700343-2 |
| CAS |
29700-34-3 |
| Structure |
 |
| Synonyms |
(S)-2-Amino-3-phenylpropanoic acid; 3-Phenyl-L-alanine; L-Phe |
| Molecular Weight |
166.18 |
| Molecular Formula |
C6H5CH2CH(15NH2)COOH |
| Canonical SMILES |
[H][C@]([15NH2])(Cc1ccccc1)C(O)=O |
| InChI |
1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/i10+1 |
| InChI Key |
COLNVLDHVKWLRT-YTRLMEAHSA-N |
| Melting Point |
270-275 °C (dec.) (lit.) |
| Purity |
99% (CP) |
| Appearance |
solid |
| Application |
Biomolecular NMR, Metabolism, Metabolomics, Proteomics |
| Storage |
Store at room temperature away from light and moisture. |
| EC Number |
200-568-1 |
| Isotopic Enrichment |
98 atom % 15N |
| Mass Shift |
M+1 |
| MDL Number |
MFCD00084235 |
| Optical Activity |
[α]25/D -33.0°, c = 1 in H2O |
| Type |
Labeled Amino Acids and Derivatives |
| Unlabeled CAS |
63-91-2 |
