| Catalog Number |
ACM121695407 |
| CAS |
121695-40-7 |
| Structure |
 |
| Synonyms |
N-Boc-L-Phenyl-D5-alanine |
| IUPAC Name |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
| Molecular Weight |
270.34 |
| Molecular Formula |
C14H14D5NO4 |
| Canonical SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])C[C@@H](C(=O)O)NC(=O)OC(C)(C)C)[2H])[2H] |
| InChI |
InChI=1S/C14H19NO4/c1-14(2,3)19-13(18)15-11(12(16)17)9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,15,18)(H,16,17)/t11-/m0/s1/i4D,5D,6D,7D,8D |
| InChI Key |
ZYJPUMXJBDHSIF-MEKJEUOKSA-N |
| Melting Point |
85-87 °C (lit.) |
| Purity |
98 atom % D |
| Appearance |
Off-white solid |
| Chemical Formula |
C6D5CH2CH(NH-t-BOC)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
13734-34-4 |
| Unlabeled Synonyms |
BOC-L-Phenylalanine; BOC-L-Phe-OH |
