| Catalog Number |
ACM56253908 |
| CAS |
56253-90-8 |
| Structure |
 |
| Synonyms |
2,3,4,5,6-Pentadeutero-L-phenylalanine |
| IUPAC Name |
(2S)-2-amino-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
| Molecular Weight |
170.22 |
| Molecular Formula |
C9H6D5NO2 |
| Canonical SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])C[C@@H](C(=O)O)N)[2H])[2H] |
| InChI |
InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/i1D,2D,3D,4D,5D |
| InChI Key |
COLNVLDHVKWLRT-HRVDQBBZSA-N |
| Melting Point |
270-275 °C (dec.) (lit.) |
| Appearance |
White solid |
| Chemical Formula |
C6D5CH2CH(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])C[C@@H](C(=O)O)N)[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
63-91-2 |
| Unlabeled Synonyms |
(S)-2-Amino-3-phenylpropionic acid; H-L-Phe-OH |
