Catalog Number |
ACM106881076 |
CAS |
106881-07-6 |
Structure |
|
IUPAC Name |
(2S)-2,3,3-trideuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
Molecular Weight |
273.36 |
Molecular Formula |
C14H11D8NO4 |
Canonical SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])[C@@]([2H])(C(=O)O)NC(=O)OC(C)(C)C)[2H])[2H] |
InChI |
InChI=1S/C14H19NO4/c1-14(2,3)19-13(18)15-11(12(16)17)9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,15,18)(H,16,17)/t11-/m0/s1/i4D,5D,6D,7D,8D,9D2,11D |
InChI Key |
ZYJPUMXJBDHSIF-ZAYSQZROSA-N |
Melting Point |
85-87 °C (lit.) |
Purity |
98 atom % D |
Chemical Formula |
C6D5CD2CD(NH-t-BOC)COOH |
Hazards |
Non-hazardous for transport. |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
Unlabeled CAS |
13734-34-4 |
Unlabeled Synonyms |
BOC-L-Phenylalanine; BOC-L-Phe-OH |