| Catalog Number |
ACM1353853390 |
| CAS |
1353853-39-0 |
| Synonyms |
N-FMOC-L-phenylalanine-d8 |
| IUPAC Name |
(2S)-2,3,3-trideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
| Molecular Weight |
395.48 |
| Molecular Formula |
C24H13D8NO4 |
| Canonical SMILES |
C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
| InChI |
InChI=1S/C24H21NO4/c26-23(27)22(14-16-8-2-1-3-9-16)25-24(28)29-15-21-19-12-6-4-10-17(19)18-11-5-7-13-20(18)21/h1-13,21-22H,14-15H2,(H,25,28)(H,26,27)/t22-/m0/s1/i1D,2D,3D,8D,9D,14D2,22D |
| InChI Key |
SJVFAHZPLIXNDH-PLPXMBJESA-N |
| Appearance |
White solid |
| Chemical Formula |
C6D5CD2CD(NH-FMOC)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
35661-40-6 |
| Unlabeled Synonyms |
FMOC-L-Phenylalanine; FMOC-L-Phe-OH |
