| Catalog Number |
ACM17942324 |
| CAS |
17942-32-4 |
| Structure |
 |
| Synonyms |
L-Phenyl-[D5]-alanine-[2,3,3-D3] |
| IUPAC Name |
(2S)-2-amino-2,3,3-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
| Molecular Weight |
173.24 |
| Molecular Formula |
C9H3D8NO2 |
| Canonical SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])[C@@]([2H])(C(=O)O)N)[2H])[2H] |
| InChI |
InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/i1D,2D,3D,4D,5D,6D2,8D |
| InChI Key |
COLNVLDHVKWLRT-WYMAAGAPSA-N |
| Melting Point |
270-275 °C (dec.) (lit.) |
| Purity |
98 atom % D |
| Chemical Formula |
C6D5CD2CD(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])[C@@]([2H])(C(=O)O)N)[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
63-91-2 |
| Unlabeled Synonyms |
(S)-2-Amino-3-phenylpropionic acid; H-L-Phe-OH |
