| Catalog Number |
ACM13010532-1 |
| CAS |
13010-53-2 |
| Structure |
 |
| Synonyms |
L-Methionine-methyl-D3 |
| IUPAC Name |
(2S)-2-amino-4-(trideuteriomethylsulfanyl)butanoic acid |
| Molecular Weight |
152.23 |
| Molecular Formula |
C5H8D3NO2S |
| Canonical SMILES |
[2H]C([2H])([2H])SCC[C@@H](C(=O)O)N |
| InChI |
InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1/i1D3 |
| InChI Key |
FFEARJCKVFRZRR-OSIBIXDNSA-N |
| Melting Point |
273 °C (dec.) (lit.) |
| Appearance |
White solid |
| Chemical Formula |
CD3SCH2CH2CH(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])SCC[C@@H](C(=O)O)N |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
63-68-3 |
| Unlabeled Synonyms |
(S)-2-Amino-4-(methylthio)butyric acid; H-L-Met-OH |
