Catalog Number |
ACM67866755 |
CAS |
67866-75-5 |
Structure |
|
Synonyms |
L-Methionine-D4 |
IUPAC Name |
(2S)-2,3-dideuterio-2-(dideuterioamino)-4-methylsulfanylbutanoic acid |
Molecular Weight |
153.23 |
Molecular Formula |
C5H7D4NO2S |
Canonical SMILES |
[2H]C(CSC)[C@@]([2H])(C(=O)O)N([2H])[2H] |
InChI |
InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1/i2D,4D/hD2/t2?,4- |
InChI Key |
FFEARJCKVFRZRR-WDNFZIOJSA-N |
Chemical Formula |
CH3SCD2CD2CH(NH2)COOH |
Hazards |
Non-hazardous for transport. |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
Unlabeled CAS |
63-68-3 |
Unlabeled Synonyms |
(S)-2-Amino-4-(methylthio)butyric acid; H-L-Met-OH |