| Catalog Number |
ACM284664966 |
| CAS |
284664-96-6 |
| Synonyms |
[2H4]-L-Lysine hydrochloride |
| IUPAC Name |
(2S)-2,6-diamino-4,4,5,5-tetradeuteriohexanoic acid;hydrochloride |
| Molecular Weight |
186.67 |
| Molecular Formula |
C6H11D4ClN2O2 |
| Canonical SMILES |
[2H]C([2H])(C[C@@H](C(=O)O)N)C([2H])([2H])CN.Cl |
| InChI |
InChI=1S/C6H14N2O2.ClH/c7-4-2-1-3-5(8)6(9)10;/h5H,1-4,7-8H2,(H,9,10);1H/t5-;/m0./s1/i1D2,2D2; |
| InChI Key |
BVHLGVCQOALMSV-UGJIAQRQSA-N |
| Melting Point |
263-264 °C (dec.) (lit.) |
| Purity |
98 atom % D |
| Chemical Formula |
H2NCH2(CD2)2CH2CH(NH2)COOH•HCl |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(C[C@@H](C(=O)O)N)C([2H])([2H])CN.Cl |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
657-27-2 |
| Unlabeled Synonyms |
(S)-2,6-Diaminohexanoic acid HCl; H-L-Lys-OH HCl |
